C22H25ClN4O3 — CID 4832721
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide (PubChem CID 4832721) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide |
|---|---|
| PubChem CID | 4832721 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NC(=O)CN2C(=O)C3C4C=CC(C4)C3C2=O)CC1 |
| InChI | InChI=1S/C22H25ClN4O3/c1-25-6-8-26(9-7-25)17-5-4-15(23)11-16(17)24-18(28)12-27-21(29)19-13-2-3-14(10-13)20(19)22(27)30/h2-5,11,13-14,19-20H,6-10,12H2,1H3,(H,24,28) |
| InChIKey | YVOLFVHXYJRKKU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|