C27H23N3O8S — CID 4833168
[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 4833168) has the molecular formula C27H23N3O8S and a molecular weight of 549.56 g/mol. Its IUPAC name is [2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 4833168 |
| Molecular Formula | C27H23N3O8S |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | [2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C27H23N3O8S/c31-26(18-37-27(32)25-12-11-24(38-25)20-5-8-22(9-6-20)30(33)34)28-13-15-29(16-14-28)39(35,36)23-10-7-19-3-1-2-4-21(19)17-23/h1-12,17H,13-16,18H2 |
| InChIKey | HHMQLUOIEAVESB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|