C23H18ClN3O5 — CID 4834582
2'-(1,3-benzodioxol-5-yl)-7-chlorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 4834582) has the molecular formula C23H18ClN3O5 and a molecular weight of 451.87 g/mol. Its IUPAC name is 2'-(1,3-benzodioxol-5-yl)-7-chlorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | 2'-(1,3-benzodioxol-5-yl)-7-chlorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 4834582 |
| Molecular Formula | C23H18ClN3O5 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2'-(1,3-benzodioxol-5-yl)-7-chlorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | O=C1C2C3CCCN3C3(C(=O)Nc4c(Cl)cccc43)C2C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18ClN3O5/c24-13-4-1-3-12-19(13)25-22(30)23(12)18-17(14-5-2-8-26(14)23)20(28)27(21(18)29)11-6-7-15-16(9-11)32-10-31-15/h1,3-4,6-7,9,14,17-18H,2,5,8,10H2,(H,25,30) |
| InChIKey | JZUUTNCIGMILIY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|