C28H23N3O5 — CID 4835154
1-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4835154) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 1-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4835154 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | O=C1C2C(Cc3ccccc3)NC3(C(=O)Nc4ccccc43)C2C(=O)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H23N3O5/c32-25-23-20(14-16-6-2-1-3-7-16)30-28(18-8-4-5-9-19(18)29-27(28)34)24(23)26(33)31(25)17-10-11-21-22(15-17)36-13-12-35-21/h1-11,15,20,23-24,30H,12-14H2,(H,29,34) |
| InChIKey | RLHWBSSYCMUDNB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|