C25H27N3O6 — CID 4835181
1-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 4835181) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4835181 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccc(CCN2C(=O)NC(=O)C3(Cc4ccccc4N4CCOCC43)C2=O)cc1OC |
| InChI | InChI=1S/C25H27N3O6/c1-32-19-8-7-16(13-20(19)33-2)9-10-28-23(30)25(22(29)26-24(28)31)14-17-5-3-4-6-18(17)27-11-12-34-15-21(25)27/h3-8,13,21H,9-12,14-15H2,1-2H3,(H,26,29,31) |
| InChIKey | VIVTYDAVBLUEPY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|