C27H32N4O3 — CID 4835721
1-(4-methylpentyl)-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4835721) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-(4-methylpentyl)-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 1-(4-methylpentyl)-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4835721 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-(4-methylpentyl)-3'-phenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CC(C)CCCN1C(=O)NC(=O)C2(Cc3ccccc3N3CCN(c4ccccc4)CC32)C1=O |
| InChI | InChI=1S/C27H32N4O3/c1-19(2)9-8-14-31-25(33)27(24(32)28-26(31)34)17-20-10-6-7-13-22(20)30-16-15-29(18-23(27)30)21-11-4-3-5-12-21/h3-7,10-13,19,23H,8-9,14-18H2,1-2H3,(H,28,32,34) |
| InChIKey | PMVUZFUMRLDTSC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|