About 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone
2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone (PubChem CID 4836291) has the molecular formula C18H20Br2N2O2
and a molecular weight of 456.18 g/mol. Its IUPAC name is 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone |
| PubChem CID | 4836291 |
| Molecular Formula | C18H20Br2N2O2 |
| Molecular Weight | 456.18 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone |
| SMILES | CCC1CCCCN1C(=O)COc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C18H20Br2N2O2/c1-2-12-6-3-4-9-22(12)16(23)11-24-18-15(20)10-14(19)13-7-5-8-21-17(13)18/h5,7-8,10,12H,2-4,6,9,11H2,1H3 |
| InChIKey | YNIRLGBNRQYQLX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone?
The IUPAC name of 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone (CID 4836291) is 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone.
What is the SMILES notation for 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone?
The canonical SMILES for 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone is CCC1CCCCN1C(=O)COc1c(Br)cc(Br)c2cccnc12.
What is the InChIKey of 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone?
The InChIKey is YNIRLGBNRQYQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Br2N2O2/c1-2-12-6-3-4-9-22(12)16(23)11-24-18-15(20)10-14(19)13-7-5-8-21-17(13)18/h5,7-8,10,12H,2-4,6,9,11H2,1H3.
What are the key properties of 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone?
2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone has a molecular weight of 456.18 g/mol, XLogP of 4.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,7-dibromoquinolin-8-yl)oxy-1-(2-ethylpiperidin-1-yl)ethanone is sourced from PubChem (CID 4836291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).