C29H19N7O2S — CID 4837539
3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]ethenyl]-1-phenylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 4837539) has the molecular formula C29H19N7O2S and a molecular weight of 529.59 g/mol. Its IUPAC name is 3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]ethenyl]-1-phenylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]ethenyl]-1-phenylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 4837539 |
| Molecular Formula | C29H19N7O2S |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-[2-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]ethenyl]-1-phenylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cn1cnnc1Sc1ccc(C=Cc2cc(-c3ccccc3)n3c(nc4ccccc43)c2C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H19N7O2S/c1-34-18-31-33-29(34)39-27-14-12-19(15-26(27)36(37)38)11-13-21-16-25(20-7-3-2-4-8-20)35-24-10-6-5-9-23(24)32-28(35)22(21)17-30/h2-16,18H,1H3 |
| InChIKey | DPKQSJMTVCOSMK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 114.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|