C34H45N3O5 — CID 4837604
methyl 2-[[2-[(17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 4837604) has the molecular formula C34H45N3O5 and a molecular weight of 575.75 g/mol. Its IUPAC name is methyl 2-[[2-[(17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[2-[(17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 4837604 |
| Molecular Formula | C34H45N3O5 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | methyl 2-[[2-[(17-hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CON=C1C=C2CCC3C(CCC4(C)C3CCC4(C)O)C2(C)CC1 |
| InChI | InChI=1S/C34H45N3O5/c1-32-14-11-23(18-22(32)9-10-25-26(32)12-15-33(2)27(25)13-16-34(33,3)40)37-42-20-30(38)36-29(31(39)41-4)17-21-19-35-28-8-6-5-7-24(21)28/h5-8,18-19,25-27,29,35,40H,9-17,20H2,1-4H3,(H,36,38) |
| InChIKey | SDHVZZNSELMHOH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|