C28H29N3O3S — CID 4837625
3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-[(2-phenylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 4837625) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-[(2-phenylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-[(2-phenylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4837625 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-[(2-phenylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccccc2-c2ccccc2)nnc1SCCOc1ccc(OCC)cc1 |
| InChI | InChI=1S/C28H29N3O3S/c1-3-18-31-27(21-34-26-13-9-8-12-25(26)22-10-6-5-7-11-22)29-30-28(31)35-20-19-33-24-16-14-23(15-17-24)32-4-2/h3,5-17H,1,4,18-21H2,2H3 |
| InChIKey | ISBIAXXOBORLMQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|