About 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline
2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline (PubChem CID 4839918) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline.
Molecular Properties
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline |
| PubChem CID | 4839918 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline |
| SMILES | COc1ccc(N2CCN(c3cc(C)c4ccc(C)cc4n3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-16-4-9-20-17(2)15-22(23-21(20)14-16)25-12-10-24(11-13-25)18-5-7-19(26-3)8-6-18/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | YBRVBNDJOVPVFV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline?
The IUPAC name of 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline (CID 4839918) is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline.
What is the SMILES notation for 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline?
The canonical SMILES for 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline is COc1ccc(N2CCN(c3cc(C)c4ccc(C)cc4n3)CC2)cc1.
What is the InChIKey of 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline?
The InChIKey is YBRVBNDJOVPVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O/c1-16-4-9-20-17(2)15-22(23-21(20)14-16)25-12-10-24(11-13-25)18-5-7-19(26-3)8-6-18/h4-9,14-15H,10-13H2,1-3H3.
What are the key properties of 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline?
2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline has a molecular weight of 347.46 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-methoxyphenyl)piperazin-1-yl]-4,7-dimethylquinoline is sourced from PubChem (CID 4839918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).