About 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide
2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 4840415) has the molecular formula C22H22N2O2S
and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide |
| PubChem CID | 4840415 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cccnc2Sc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-15-6-11-19(13-16(15)2)27-22-20(5-4-12-23-22)21(25)24-14-17-7-9-18(26-3)10-8-17/h4-13H,14H2,1-3H3,(H,24,25) |
| InChIKey | IVTWGNKMFHXRAL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide?
The IUPAC name of 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide (CID 4840415) is 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide.
What is the SMILES notation for 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide?
The canonical SMILES for 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide is COc1ccc(CNC(=O)c2cccnc2Sc2ccc(C)c(C)c2)cc1.
What is the InChIKey of 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide?
The InChIKey is IVTWGNKMFHXRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2S/c1-15-6-11-19(13-16(15)2)27-22-20(5-4-12-23-22)21(25)24-14-17-7-9-18(26-3)10-8-17/h4-13H,14H2,1-3H3,(H,24,25).
What are the key properties of 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide?
2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide has a molecular weight of 378.50 g/mol, XLogP of 4.79, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)sulfanyl-N-[(4-methoxyphenyl)methyl]pyridine-3-carboxamide is sourced from PubChem (CID 4840415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).