C17H20Cl3NO5S — CID 4840497
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 4840497) has the molecular formula C17H20Cl3NO5S and a molecular weight of 456.78 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 4840497 |
| Molecular Formula | C17H20Cl3NO5S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | CC(C)CN(C(=O)COC(=O)c1c(Cl)ccc(Cl)c1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20Cl3NO5S/c1-10(2)7-21(11-5-6-27(24,25)9-11)14(22)8-26-17(23)15-12(18)3-4-13(19)16(15)20/h3-4,10-11H,5-9H2,1-2H3 |
| InChIKey | BADROXZZUOQEOI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|