C15H15ClN2O3S — CID 4841050
4-chloro-N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 4841050) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is 4-chloro-N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-chloro-N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 4841050 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-chloro-N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | O=C(CCCCl)Nc1nc(-c2ccc3c(c2)OCCO3)cs1 |
| InChI | InChI=1S/C15H15ClN2O3S/c16-5-1-2-14(19)18-15-17-11(9-22-15)10-3-4-12-13(8-10)21-7-6-20-12/h3-4,8-9H,1-2,5-7H2,(H,17,18,19) |
| InChIKey | HJSWUMGXUDRBDH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|