C19H25N3O6S — CID 4841230
1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine (PubChem CID 4841230) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4841230 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-N'-(4-methylsulfonyl-2-nitrophenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(CNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])N(C)C)cc1OC |
| InChI | InChI=1S/C19H25N3O6S/c1-21(2)17(13-6-9-18(27-3)19(10-13)28-4)12-20-15-8-7-14(29(5,25)26)11-16(15)22(23)24/h6-11,17,20H,12H2,1-5H3 |
| InChIKey | FCAZPQZPJLFFSQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|