C20H19Cl3N4O4S — CID 4841739
2-[methyl-[(4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-7-yl)sulfonyl]amino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 4841739) has the molecular formula C20H19Cl3N4O4S and a molecular weight of 517.82 g/mol. Its IUPAC name is 2-[methyl-[(4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-7-yl)sulfonyl]amino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[methyl-[(4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-7-yl)sulfonyl]amino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4841739 |
| Molecular Formula | C20H19Cl3N4O4S |
| Molecular Weight | 517.82 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 2-[methyl-[(4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-7-yl)sulfonyl]amino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)S(=O)(=O)c1ccc2c(c1)NC(=O)C1CCCN21 |
| InChI | InChI=1S/C20H19Cl3N4O4S/c1-26(10-19(28)24-15-9-13(22)12(21)8-14(15)23)32(30,31)11-4-5-17-16(7-11)25-20(29)18-3-2-6-27(17)18/h4-5,7-9,18H,2-3,6,10H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | AGASBVITALBSTC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|