About 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide
1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 4843067) has the molecular formula C21H26N4O4S
and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide |
| PubChem CID | 4843067 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c22-30(28,29)19-8-6-16(7-9-19)10-13-23-20(26)17-11-14-25(15-12-17)21(27)24-18-4-2-1-3-5-18/h1-9,17H,10-15H2,(H,23,26)(H,24,27)(H2,22,28,29) |
| InChIKey | WBXHDUAPULOLAW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide?
The IUPAC name of 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide (CID 4843067) is 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide is NS(=O)(=O)c1ccc(CCNC(=O)C2CCN(C(=O)Nc3ccccc3)CC2)cc1.
What is the InChIKey of 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide?
The InChIKey is WBXHDUAPULOLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O4S/c22-30(28,29)19-8-6-16(7-9-19)10-13-23-20(26)17-11-14-25(15-12-17)21(27)24-18-4-2-1-3-5-18/h1-9,17H,10-15H2,(H,23,26)(H,24,27)(H2,22,28,29).
What are the key properties of 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide?
1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide has a molecular weight of 430.53 g/mol, XLogP of 1.94, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide is sourced from PubChem (CID 4843067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).