C21H26N4O4S — CID 4843067
1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 4843067) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4843067 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-N-phenyl-4-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c22-30(28,29)19-8-6-16(7-9-19)10-13-23-20(26)17-11-14-25(15-12-17)21(27)24-18-4-2-1-3-5-18/h1-9,17H,10-15H2,(H,23,26)(H,24,27)(H2,22,28,29) |
| InChIKey | WBXHDUAPULOLAW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |