C15H13N3O6S — CID 4843131
[2-(4-acetamidoanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate (PubChem CID 4843131) has the molecular formula C15H13N3O6S and a molecular weight of 363.35 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4843131 |
| Molecular Formula | C15H13N3O6S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2ccc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C15H13N3O6S/c1-9(19)16-10-2-4-11(5-3-10)17-13(20)8-24-15(21)12-6-7-14(25-12)18(22)23/h2-7H,8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | AGDGLKUOKZBLSK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|