C23H31FN4O5S — CID 4843577
3-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 4843577) has the molecular formula C23H31FN4O5S and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 4843577 |
| Molecular Formula | C23H31FN4O5S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 3-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)N1CCN(S(=O)(=O)c3cccc(F)c3)CC1)C2=O |
| InChI | InChI=1S/C23H31FN4O5S/c1-16-12-22(2,3)15-23(13-16)20(30)28(21(31)25-23)14-19(29)26-7-9-27(10-8-26)34(32,33)18-6-4-5-17(24)11-18/h4-6,11,16H,7-10,12-15H2,1-3H3,(H,25,31) |
| InChIKey | MNFMCOARTINDBM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|