C21H24N4O4S — CID 4843659
6-methyl-2-[[2-[[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4843659) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 6-methyl-2-[[2-[[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-methyl-2-[[2-[[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4843659 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 6-methyl-2-[[2-[[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C=NOCC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)cc1 |
| InChI | InChI=1S/C21H24N4O4S/c1-12-3-6-14(7-4-12)24-17(26)10-23-29-11-18(27)25-21-19(20(22)28)15-8-5-13(2)9-16(15)30-21/h3-4,6-7,10,13H,5,8-9,11H2,1-2H3,(H2,22,28)(H,24,26)(H,25,27) |
| InChIKey | AHQMOZUKOBSOHU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|