C16H19N5O6 — CID 4843745
1-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-3-cyclopentylimidazolidine-2,4,5-trione (PubChem CID 4843745) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-3-cyclopentylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-3-cyclopentylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 4843745 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl]-3-cyclopentylimidazolidine-2,4,5-trione |
| SMILES | Cn1c(N)c(C(=O)CN2C(=O)C(=O)N(C3CCCC3)C2=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H19N5O6/c1-18-11(17)10(12(23)19(2)15(18)26)9(22)7-20-13(24)14(25)21(16(20)27)8-5-3-4-6-8/h8H,3-7,17H2,1-2H3 |
| InChIKey | MDZBYVTVXPQZPY-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|