About [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate
[2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 4843760) has the molecular formula C20H20N4O5S
and a molecular weight of 428.47 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| PubChem CID | 4843760 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2)n1 |
| InChI | InChI=1S/C20H20N4O5S/c1-13-11-14(2)24(23-13)17-7-3-15(4-8-17)20(26)29-12-19(25)22-16-5-9-18(10-6-16)30(21,27)28/h3-11H,12H2,1-2H3,(H,22,25)(H2,21,27,28) |
| InChIKey | GZYSJKBOLBVBTG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The IUPAC name of [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (CID 4843760) is [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
What is the SMILES notation for [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The canonical SMILES for [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate is Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2)n1.
What is the InChIKey of [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The InChIKey is GZYSJKBOLBVBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O5S/c1-13-11-14(2)24(23-13)17-7-3-15(4-8-17)20(26)29-12-19(25)22-16-5-9-18(10-6-16)30(21,27)28/h3-11H,12H2,1-2H3,(H,22,25)(H2,21,27,28).
What are the key properties of [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
[2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate has a molecular weight of 428.47 g/mol, XLogP of 1.93, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate is sourced from PubChem (CID 4843760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).