About [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate
[2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate (PubChem CID 4843799) has the molecular formula C12H8BrN3O5S
and a molecular weight of 386.18 g/mol. Its IUPAC name is [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate.
Molecular Properties
| Compound Name | [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate |
| PubChem CID | 4843799 |
| Molecular Formula | C12H8BrN3O5S |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cccc([N+](=O)[O-])c1)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C12H8BrN3O5S/c13-9-5-14-12(22-9)15-10(17)6-21-11(18)7-2-1-3-8(4-7)16(19)20/h1-5H,6H2,(H,14,15,17) |
| InChIKey | MTTITHTVQCJRPW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate?
The IUPAC name of [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate (CID 4843799) is [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate.
What is the SMILES notation for [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate?
The canonical SMILES for [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate is O=C(COC(=O)c1cccc([N+](=O)[O-])c1)Nc1ncc(Br)s1.
What is the InChIKey of [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate?
The InChIKey is MTTITHTVQCJRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN3O5S/c13-9-5-14-12(22-9)15-10(17)6-21-11(18)7-2-1-3-8(4-7)16(19)20/h1-5H,6H2,(H,14,15,17).
What are the key properties of [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate?
[2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate has a molecular weight of 386.18 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3-nitrobenzoate is sourced from PubChem (CID 4843799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).