C16H16F4N2O3 — CID 4843810
oxolan-2-yl-[4-(2,3,4,5-tetrafluorobenzoyl)piperazin-1-yl]methanone (PubChem CID 4843810) has the molecular formula C16H16F4N2O3 and a molecular weight of 360.31 g/mol. Its IUPAC name is oxolan-2-yl-[4-(2,3,4,5-tetrafluorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | oxolan-2-yl-[4-(2,3,4,5-tetrafluorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4843810 |
| Molecular Formula | C16H16F4N2O3 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | oxolan-2-yl-[4-(2,3,4,5-tetrafluorobenzoyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C16H16F4N2O3/c17-10-8-9(12(18)14(20)13(10)19)15(23)21-3-5-22(6-4-21)16(24)11-2-1-7-25-11/h8,11H,1-7H2 |
| InChIKey | VNZAKBYVGJBTOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|