About 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide
1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide (PubChem CID 4844514) has the molecular formula C19H20N4O5S
and a molecular weight of 416.46 g/mol. Its IUPAC name is 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide |
| PubChem CID | 4844514 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC(C)c3ccc(S(N)(=O)=O)cc3)ccc21 |
| InChI | InChI=1S/C19H20N4O5S/c1-3-23-16-9-6-13(10-15(16)22-18(25)19(23)26)17(24)21-11(2)12-4-7-14(8-5-12)29(20,27)28/h4-11H,3H2,1-2H3,(H,21,24)(H,22,25)(H2,20,27,28) |
| InChIKey | VXNDWSCYUNQXEG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide?
The IUPAC name of 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide (CID 4844514) is 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide.
What is the SMILES notation for 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide?
The canonical SMILES for 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide is CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC(C)c3ccc(S(N)(=O)=O)cc3)ccc21.
What is the InChIKey of 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide?
The InChIKey is VXNDWSCYUNQXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O5S/c1-3-23-16-9-6-13(10-15(16)22-18(25)19(23)26)17(24)21-11(2)12-4-7-14(8-5-12)29(20,27)28/h4-11H,3H2,1-2H3,(H,21,24)(H,22,25)(H2,20,27,28).
What are the key properties of 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide?
1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide has a molecular weight of 416.46 g/mol, XLogP of 0.85, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dioxo-N-[1-(4-sulfamoylphenyl)ethyl]-4H-quinoxaline-6-carboxamide is sourced from PubChem (CID 4844514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).