C16H13N3S2 — CID 4845472
1-(4-methylphenyl)-6-phenyl-1,3,5-triazine-2,4-dithione (PubChem CID 4845472) has the molecular formula C16H13N3S2 and a molecular weight of 311.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-6-phenyl-1,3,5-triazine-2,4-dithione.
| Compound Name | 1-(4-methylphenyl)-6-phenyl-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 4845472 |
| Molecular Formula | C16H13N3S2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-(4-methylphenyl)-6-phenyl-1,3,5-triazine-2,4-dithione |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nc(=S)[nH]c2=S)cc1 |
| InChI | InChI=1S/C16H13N3S2/c1-11-7-9-13(10-8-11)19-14(12-5-3-2-4-6-12)17-15(20)18-16(19)21/h2-10H,1H3,(H,18,20,21) |
| InChIKey | FHYJRAZJUAOQFX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|