About [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate
[3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 4847357) has the molecular formula C17H10ClFN2O3S2
and a molecular weight of 408.86 g/mol. Its IUPAC name is [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| PubChem CID | 4847357 |
| Molecular Formula | C17H10ClFN2O3S2 |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1csc(C(C#N)C(=O)COC(=O)c2sc3cc(F)ccc3c2Cl)n1 |
| InChI | InChI=1S/C17H10ClFN2O3S2/c1-8-7-25-16(21-8)11(5-20)12(22)6-24-17(23)15-14(18)10-3-2-9(19)4-13(10)26-15/h2-4,7,11H,6H2,1H3 |
| InChIKey | UFWJXKRQQRFELL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
The IUPAC name of [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (CID 4847357) is [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
The canonical SMILES for [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate is Cc1csc(C(C#N)C(=O)COC(=O)c2sc3cc(F)ccc3c2Cl)n1.
What is the InChIKey of [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
The InChIKey is UFWJXKRQQRFELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClFN2O3S2/c1-8-7-25-16(21-8)11(5-20)12(22)6-24-17(23)15-14(18)10-3-2-9(19)4-13(10)26-15/h2-4,7,11H,6H2,1H3.
What are the key properties of [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
[3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate has a molecular weight of 408.86 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 4847357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).