C16H19N3O5S — CID 4847522
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 4847522) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 4847522 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-19-10-2-3-14(19)16(21)24-11-15(20)18-9-8-12-4-6-13(7-5-12)25(17,22)23/h2-7,10H,8-9,11H2,1H3,(H,18,20)(H2,17,22,23) |
| InChIKey | NIIDYXMWILYDCL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |