C16H19N5O4 — CID 4847625
[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 4-(carbamoylamino)benzoate (PubChem CID 4847625) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 4-(carbamoylamino)benzoate.
| Compound Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 4847625 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 4-(carbamoylamino)benzoate |
| SMILES | CC(C)n1nccc1NC(=O)COC(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C16H19N5O4/c1-10(2)21-13(7-8-18-21)20-14(22)9-25-15(23)11-3-5-12(6-4-11)19-16(17)24/h3-8,10H,9H2,1-2H3,(H,20,22)(H3,17,19,24) |
| InChIKey | HOWQEAIMFDFBEP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |