C21H22N2O3S — CID 4848229
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methoxypropyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 4848229) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methoxypropyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methoxypropyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4848229 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methoxypropyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | COCCCn1c(-c2ccc3c(c2)OCCO3)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-24-11-5-10-23-18(15-27-21(23)22-17-6-3-2-4-7-17)16-8-9-19-20(14-16)26-13-12-25-19/h2-4,6-9,14-15H,5,10-13H2,1H3/b22-21- |
| InChIKey | YXNLKDOQUXSGDT-DQRAZIAOSA-N |
| XLogP | 4.26 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|