C15H9Cl2NS — CID 4848834
3,5-dichloro-2-naphthalen-2-ylsulfanylpyridine (PubChem CID 4848834) has the molecular formula C15H9Cl2NS and a molecular weight of 306.22 g/mol. Its IUPAC name is 3,5-dichloro-2-naphthalen-2-ylsulfanylpyridine.
| Compound Name | 3,5-dichloro-2-naphthalen-2-ylsulfanylpyridine |
|---|---|
| PubChem CID | 4848834 |
| Molecular Formula | C15H9Cl2NS |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 3,5-dichloro-2-naphthalen-2-ylsulfanylpyridine |
| SMILES | Clc1cnc(Sc2ccc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2NS/c16-12-8-14(17)15(18-9-12)19-13-6-5-10-3-1-2-4-11(10)7-13/h1-9H |
| InChIKey | QBBYXFVSGJFCCF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |