C20H18N4O5S — CID 4849271
N-(2-methoxyphenyl)-2-[5-[[4-(methylamino)-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 4849271) has the molecular formula C20H18N4O5S and a molecular weight of 426.45 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[5-[[4-(methylamino)-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[5-[[4-(methylamino)-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 4849271 |
| Molecular Formula | C20H18N4O5S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[5-[[4-(methylamino)-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | CNc1ccc(C=c2sc(=CC(=O)Nc3ccccc3OC)[nH]c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N4O5S/c1-21-13-8-7-12(9-15(13)24(27)28)10-17-20(26)23-19(30-17)11-18(25)22-14-5-3-4-6-16(14)29-2/h3-11,21H,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | RIPLHQKGRRJNFB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|