C25H25N3O3S2 — CID 4849871
ethyl 3-oxo-2-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-4H-1,4-benzothiazine-2-carboxylate (PubChem CID 4849871) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is ethyl 3-oxo-2-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-4H-1,4-benzothiazine-2-carboxylate.
| Compound Name | ethyl 3-oxo-2-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-4H-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 4849871 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | ethyl 3-oxo-2-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-4H-1,4-benzothiazine-2-carboxylate |
| SMILES | CCOC(=O)C1(c2sc(N3CCCCC3)nc2-c2ccccc2)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C25H25N3O3S2/c1-2-31-23(30)25(22(29)26-18-13-7-8-14-19(18)33-25)21-20(17-11-5-3-6-12-17)27-24(32-21)28-15-9-4-10-16-28/h3,5-8,11-14H,2,4,9-10,15-16H2,1H3,(H,26,29) |
| InChIKey | JAQPUPWOBZUPFJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|