C20H19N5O5 — CID 48501783
4-imidazol-1-yl-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 48501783) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is 4-imidazol-1-yl-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | 4-imidazol-1-yl-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 48501783 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-imidazol-1-yl-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | COc1ccc(CNC(=O)CNC(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H19N5O5/c1-30-16-5-2-14(3-6-16)11-22-19(26)12-23-20(27)15-4-7-17(18(10-15)25(28)29)24-9-8-21-13-24/h2-10,13H,11-12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | WFFZSOXJKXQMGH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|