C11H17N3O3S — CID 485037
tert-butyl N-[1-(4-carbamoylthiazol-2-yl)ethyl]carbamate (PubChem CID 485037) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is tert-butyl N-[1-(4-carbamoyl-1,3-thiazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-carbamoylthiazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 485037 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | tert-butyl N-[1-(4-carbamoyl-1,3-thiazol-2-yl)ethyl]carbamate |
| SMILES | CC(C1=NC(=CS1)C(=O)N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17N3O3S/c1-6(13-10(16)17-11(2,3)4)9-14-7(5-18-9)8(12)15/h5-6H,1-4H3,(H2,12,15)(H,13,16) |
| InChIKey | MLCJNOOEQFHVFJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | 330 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |