C21H19N7O4S — CID 4850374
N'-[2-[[4-(2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-oxo-3H-phthalazine-1-carbohydrazide (PubChem CID 4850374) has the molecular formula C21H19N7O4S and a molecular weight of 465.50 g/mol. Its IUPAC name is N'-[2-[[4-(2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-oxo-3H-phthalazine-1-carbohydrazide.
| Compound Name | N'-[2-[[4-(2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 4850374 |
| Molecular Formula | C21H19N7O4S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N'-[2-[[4-(2-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
| SMILES | COc1ccccc1-n1c(C)nnc1SCC(=O)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H19N7O4S/c1-12-22-27-21(28(12)15-9-5-6-10-16(15)32-2)33-11-17(29)23-26-20(31)18-13-7-3-4-8-14(13)19(30)25-24-18/h3-10H,11H2,1-2H3,(H,23,29)(H,25,30)(H,26,31) |
| InChIKey | HQJZCFJKQRENIK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|