About 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone
1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 48504466) has the molecular formula C16H24N4O2S
and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone |
| PubChem CID | 48504466 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(C(=O)N2CCCN(c3nccs3)CC2)C1 |
| InChI | InChI=1S/C16H24N4O2S/c1-13(21)20-6-2-4-14(12-20)15(22)18-7-3-8-19(10-9-18)16-17-5-11-23-16/h5,11,14H,2-4,6-10,12H2,1H3 |
| InChIKey | QYEZRMPULFCDSA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone?
The IUPAC name of 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone (CID 48504466) is 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone?
The canonical SMILES for 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone is CC(=O)N1CCCC(C(=O)N2CCCN(c3nccs3)CC2)C1.
What is the InChIKey of 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone?
The InChIKey is QYEZRMPULFCDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O2S/c1-13(21)20-6-2-4-14(12-20)15(22)18-7-3-8-19(10-9-18)16-17-5-11-23-16/h5,11,14H,2-4,6-10,12H2,1H3.
What are the key properties of 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone?
1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone has a molecular weight of 336.46 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]piperidin-1-yl]ethanone is sourced from PubChem (CID 48504466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).