C18H24N4O — CID 48508171
1-benzyl-N-(5-ethyl-1H-pyrazol-3-yl)piperidine-3-carboxamide (PubChem CID 48508171) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-benzyl-N-(5-ethyl-1H-pyrazol-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-(5-ethyl-1H-pyrazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 48508171 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-benzyl-N-(5-ethyl-1H-pyrazol-3-yl)piperidine-3-carboxamide |
| SMILES | CCc1cc(NC(=O)C2CCCN(Cc3ccccc3)C2)n[nH]1 |
| InChI | InChI=1S/C18H24N4O/c1-2-16-11-17(21-20-16)19-18(23)15-9-6-10-22(13-15)12-14-7-4-3-5-8-14/h3-5,7-8,11,15H,2,6,9-10,12-13H2,1H3,(H2,19,20,21,23) |
| InChIKey | FOLTVCQPEQKYQR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |