About 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide
2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide (PubChem CID 4851120) has the molecular formula C19H18N4O5
and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide.
Molecular Properties
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide |
| PubChem CID | 4851120 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide |
| SMILES | Cc1ccccc1OCC(=O)NNC(=O)Cn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C19H18N4O5/c1-12-6-2-5-9-15(12)28-11-17(25)21-20-16(24)10-23-19(27)14-8-4-3-7-13(14)18(26)22-23/h2-9H,10-11H2,1H3,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | QBIZDIJOPFAAGN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide?
The IUPAC name of 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide (CID 4851120) is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide.
What is the SMILES notation for 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide?
The canonical SMILES for 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide is Cc1ccccc1OCC(=O)NNC(=O)Cn1[nH]c(=O)c2ccccc2c1=O.
What is the InChIKey of 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide?
The InChIKey is QBIZDIJOPFAAGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O5/c1-12-6-2-5-9-15(12)28-11-17(25)21-20-16(24)10-23-19(27)14-8-4-3-7-13(14)18(26)22-23/h2-9H,10-11H2,1H3,(H,20,24)(H,21,25)(H,22,26).
What are the key properties of 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide?
2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide has a molecular weight of 382.38 g/mol, XLogP of 0.22, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide is sourced from PubChem (CID 4851120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).