C26H22N4O7 — CID 4851484
[2-(3,5-dicarbamoylanilino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 4851484) has the molecular formula C26H22N4O7 and a molecular weight of 502.48 g/mol. Its IUPAC name is [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 4851484 |
| Molecular Formula | C26H22N4O7 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | NC(=O)c1cc(NC(=O)COC(=O)CCCN2C(=O)c3cccc4cccc(c34)C2=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C26H22N4O7/c27-23(33)15-10-16(24(28)34)12-17(11-15)29-20(31)13-37-21(32)8-3-9-30-25(35)18-6-1-4-14-5-2-7-19(22(14)18)26(30)36/h1-2,4-7,10-12H,3,8-9,13H2,(H2,27,33)(H2,28,34)(H,29,31) |
| InChIKey | ORDAJCWYBZESJH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 178.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|