C23H29N3O3 — CID 48515720
N-[(4-methoxyphenyl)methyl]-2-[(4-phenylcyclohexyl)carbamoylamino]acetamide (PubChem CID 48515720) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[(4-phenylcyclohexyl)carbamoylamino]acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[(4-phenylcyclohexyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 48515720 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[(4-phenylcyclohexyl)carbamoylamino]acetamide |
| SMILES | COc1ccc(CNC(=O)CNC(=O)NC2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-29-21-13-7-17(8-14-21)15-24-22(27)16-25-23(28)26-20-11-9-19(10-12-20)18-5-3-2-4-6-18/h2-8,13-14,19-20H,9-12,15-16H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | LODYFTOXEVRJIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |