About 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea
3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea (PubChem CID 48519716) has the molecular formula C17H30N4O3
and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea |
| PubChem CID | 48519716 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea |
| SMILES | COCCn1nc(C)c(CNC(=O)N(C)CC2CCCCO2)c1C |
| InChI | InChI=1S/C17H30N4O3/c1-13-16(14(2)21(19-13)8-10-23-4)11-18-17(22)20(3)12-15-7-5-6-9-24-15/h15H,5-12H2,1-4H3,(H,18,22) |
| InChIKey | NLJVMWLYQVGIKN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea?
The IUPAC name of 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea (CID 48519716) is 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea.
What is the SMILES notation for 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea?
The canonical SMILES for 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea is COCCn1nc(C)c(CNC(=O)N(C)CC2CCCCO2)c1C.
What is the InChIKey of 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea?
The InChIKey is NLJVMWLYQVGIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4O3/c1-13-16(14(2)21(19-13)8-10-23-4)11-18-17(22)20(3)12-15-7-5-6-9-24-15/h15H,5-12H2,1-4H3,(H,18,22).
What are the key properties of 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea?
3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea has a molecular weight of 338.45 g/mol, XLogP of 1.86, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-1-methyl-1-(oxan-2-ylmethyl)urea is sourced from PubChem (CID 48519716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).