C17H17F4NO2 — CID 4851981
N-cycloheptyl-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 4851981) has the molecular formula C17H17F4NO2 and a molecular weight of 343.32 g/mol. Its IUPAC name is N-cycloheptyl-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-cycloheptyl-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 4851981 |
| Molecular Formula | C17H17F4NO2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-cycloheptyl-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(F)c(F)c(F)c(F)c2c1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C17H17F4NO2/c1-8-10(17(23)22-9-6-4-2-3-5-7-9)11-12(18)13(19)14(20)15(21)16(11)24-8/h9H,2-7H2,1H3,(H,22,23) |
| InChIKey | YKFYBDFYBHOQIP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|