About 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide
2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 4853219) has the molecular formula C19H17FN2O2S2
and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide |
| PubChem CID | 4853219 |
| Molecular Formula | C19H17FN2O2S2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CSc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C19H17FN2O2S2/c1-12-3-8-17(24-2)15(9-12)21-18(23)11-26-19-22-16(10-25-19)13-4-6-14(20)7-5-13/h3-10H,11H2,1-2H3,(H,21,23) |
| InChIKey | HWJZHLNDNVOXFE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide?
The IUPAC name of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide (CID 4853219) is 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide.
What is the SMILES notation for 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide?
The canonical SMILES for 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide is COc1ccc(C)cc1NC(=O)CSc1nc(-c2ccc(F)cc2)cs1.
What is the InChIKey of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide?
The InChIKey is HWJZHLNDNVOXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O2S2/c1-12-3-8-17(24-2)15(9-12)21-18(23)11-26-19-22-16(10-25-19)13-4-6-14(20)7-5-13/h3-10H,11H2,1-2H3,(H,21,23).
What are the key properties of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide?
2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide has a molecular weight of 388.49 g/mol, XLogP of 5.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(2-methoxy-5-methylphenyl)acetamide is sourced from PubChem (CID 4853219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).