C19H19N3O4S2 — CID 4853292
N-(2-methyl-1,3-benzothiazol-6-yl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 4853292) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4853292 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1nc2ccc(NC(=O)c3cccc(S(=O)(=O)N4CCOCC4)c3)cc2s1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-13-20-17-6-5-15(12-18(17)27-13)21-19(23)14-3-2-4-16(11-14)28(24,25)22-7-9-26-10-8-22/h2-6,11-12H,7-10H2,1H3,(H,21,23) |
| InChIKey | SOELJQAUXCYVFL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |