C26H30N4OS — CID 4854213
1-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 4854213) has the molecular formula C26H30N4OS and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4854213 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | CCN1CCN(c2ccc(NC(=S)Nc3ccc(Oc4ccccc4)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C26H30N4OS/c1-3-29-15-17-30(18-16-29)22-11-14-25(20(2)19-22)28-26(32)27-21-9-12-24(13-10-21)31-23-7-5-4-6-8-23/h4-14,19H,3,15-18H2,1-2H3,(H2,27,28,32) |
| InChIKey | NRSLOLOGBTUBCU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|