C10H10Cl2N4S2 — CID 4854445
3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 4854445) has the molecular formula C10H10Cl2N4S2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 4854445 |
| Molecular Formula | C10H10Cl2N4S2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(SCCSc2cc(Cl)ccc2Cl)n[nH]1 |
| InChI | InChI=1S/C10H10Cl2N4S2/c11-6-1-2-7(12)8(5-6)17-3-4-18-10-14-9(13)15-16-10/h1-2,5H,3-4H2,(H3,13,14,15,16) |
| InChIKey | NZYYXYXLTULMTI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|