C18H18F3N5O2S — CID 4854579
2-[[4-ethyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4854579) has the molecular formula C18H18F3N5O2S and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[[4-ethyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4854579 |
| Molecular Formula | C18H18F3N5O2S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[[4-ethyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCn1c(-c2ccco2)nn(CN(C)CC(=O)Nc2ccc(F)c(F)c2F)c1=S |
| InChI | InChI=1S/C18H18F3N5O2S/c1-3-25-17(13-5-4-8-28-13)23-26(18(25)29)10-24(2)9-14(27)22-12-7-6-11(19)15(20)16(12)21/h4-8H,3,9-10H2,1-2H3,(H,22,27) |
| InChIKey | ZBYRBZAWFRQHLF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|