C20H20N4OS2 — CID 4855106
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 4855106) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4855106 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-5,6-dimethyl-2-pyridin-3-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(-c3cccnc3)nc(NCCSCc3ccco3)c2c1C |
| InChI | InChI=1S/C20H20N4OS2/c1-13-14(2)27-20-17(13)19(22-8-10-26-12-16-6-4-9-25-16)23-18(24-20)15-5-3-7-21-11-15/h3-7,9,11H,8,10,12H2,1-2H3,(H,22,23,24) |
| InChIKey | DUTLPXXFFAPKOC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|