About 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide (PubChem CID 4855112) has the molecular formula C14H23N5O3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide |
| PubChem CID | 4855112 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide |
| SMILES | CCCCn1c(N)c(N2CCC(C(N)=O)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23N5O3/c1-2-3-6-19-11(15)10(13(21)17-14(19)22)18-7-4-9(5-8-18)12(16)20/h9H,2-8,15H2,1H3,(H2,16,20)(H,17,21,22) |
| InChIKey | UQYOOYLSNMCHCX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide?
The IUPAC name of 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide (CID 4855112) is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide?
The canonical SMILES for 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide is CCCCn1c(N)c(N2CCC(C(N)=O)CC2)c(=O)[nH]c1=O.
What is the InChIKey of 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide?
The InChIKey is UQYOOYLSNMCHCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O3/c1-2-3-6-19-11(15)10(13(21)17-14(19)22)18-7-4-9(5-8-18)12(16)20/h9H,2-8,15H2,1H3,(H2,16,20)(H,17,21,22).
What are the key properties of 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide?
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide has a molecular weight of 309.37 g/mol, XLogP of -0.38, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)piperidine-4-carboxamide is sourced from PubChem (CID 4855112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).